C30H35N3O3 — CID 134345245
2-amino-N-[6-[(5-hydroxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(4-hydroxy-2,6-dimethylphenyl)propanamide (PubChem CID 134345245) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-amino-N-[6-[(5-hydroxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(4-hydroxy-2,6-dimethylphenyl)propanamide.
| Compound Name | 2-amino-N-[6-[(5-hydroxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134345245 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-amino-N-[6-[(5-hydroxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
| SMILES | Cc1cc(O)cc(C)c1CC(N)C(=O)NC1CCNc2ccc(CC3Cc4ccc(O)cc4C3)cc21 |
| InChI | InChI=1S/C30H35N3O3/c1-17-9-24(35)10-18(2)25(17)16-27(31)30(36)33-29-7-8-32-28-6-3-19(14-26(28)29)11-20-12-21-4-5-23(34)15-22(21)13-20/h3-6,9-10,14-15,20,27,29,32,34-35H,7-8,11-13,16,31H2,1-2H3,(H,33,36) |
| InChIKey | RUVUKXFLKUYAFZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |