C15H18FN — CID 142308800
3-[(E)-2-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]-1-prop-2-ynylpyrrolidine (PubChem CID 142308800) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is 3-[(E)-2-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]-1-prop-2-ynylpyrrolidine.
| Compound Name | 3-[(E)-2-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]-1-prop-2-ynylpyrrolidine |
|---|---|
| PubChem CID | 142308800 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-[(E)-2-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]-1-prop-2-ynylpyrrolidine |
| SMILES | C#CCN1CCC(/C=C/C2=CCC(F)C=C2)C1 |
| InChI | InChI=1S/C15H18FN/c1-2-10-17-11-9-14(12-17)4-3-13-5-7-15(16)8-6-13/h1,3-7,14-15H,8-12H2/b4-3+ |
| InChIKey | SJYTXNPPRNGKHY-ONEGZZNKSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|