C19H23N — CID 134385649
4-[(E)-2-(4-cyclopropylphenyl)ethenyl]-1-prop-2-ynylpiperidine (PubChem CID 134385649) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(E)-2-(4-cyclopropylphenyl)ethenyl]-1-prop-2-ynylpiperidine.
| Compound Name | 4-[(E)-2-(4-cyclopropylphenyl)ethenyl]-1-prop-2-ynylpiperidine |
|---|---|
| PubChem CID | 134385649 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[(E)-2-(4-cyclopropylphenyl)ethenyl]-1-prop-2-ynylpiperidine |
| SMILES | C#CCN1CCC(/C=C/c2ccc(C3CC3)cc2)CC1 |
| InChI | InChI=1S/C19H23N/c1-2-13-20-14-11-17(12-15-20)4-3-16-5-7-18(8-6-16)19-9-10-19/h1,3-8,17,19H,9-15H2/b4-3+ |
| InChIKey | ZXUYGLWTOBEVCF-ONEGZZNKSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|