C8H12N2 — CID 142308881
(3Z)-N-methyl-3-propylidene-1H-pyrrol-2-imine (PubChem CID 142308881) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (3Z)-N-methyl-3-propylidene-1H-pyrrol-2-imine.
| Compound Name | (3Z)-N-methyl-3-propylidene-1H-pyrrol-2-imine |
|---|---|
| PubChem CID | 142308881 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (3Z)-N-methyl-3-propylidene-1H-pyrrol-2-imine |
| SMILES | CC/C=C1/C=CN/C1=N\C |
| InChI | InChI=1S/C8H12N2/c1-3-4-7-5-6-10-8(7)9-2/h4-6H,3H2,1-2H3,(H,9,10)/b7-4- |
| InChIKey | CLMIZXCBZWMNRO-DAXSKMNVSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|