C18H16ClF3N2O4S — CID 142309644
5-chloro-2-[3-hydroxy-3-(hydroxymethyl)pyrrolidin-1-yl]sulfinylbenzonitrile;2,4,5-trifluorophenol (PubChem CID 142309644) has the molecular formula C18H16ClF3N2O4S and a molecular weight of 448.85 g/mol. Its IUPAC name is 5-chloro-2-[3-hydroxy-3-(hydroxymethyl)pyrrolidin-1-yl]sulfinylbenzonitrile;2,4,5-trifluorophenol.
| Compound Name | 5-chloro-2-[3-hydroxy-3-(hydroxymethyl)pyrrolidin-1-yl]sulfinylbenzonitrile;2,4,5-trifluorophenol |
|---|---|
| PubChem CID | 142309644 |
| Molecular Formula | C18H16ClF3N2O4S |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 5-chloro-2-[3-hydroxy-3-(hydroxymethyl)pyrrolidin-1-yl]sulfinylbenzonitrile;2,4,5-trifluorophenol |
| SMILES | N#Cc1cc(Cl)ccc1S(=O)N1CCC(O)(CO)C1.Oc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H13ClN2O3S.C6H3F3O/c13-10-1-2-11(9(5-10)6-14)19(18)15-4-3-12(17,7-15)8-16;7-3-1-5(9)6(10)2-4(3)8/h1-2,5,16-17H,3-4,7-8H2;1-2,10H |
| InChIKey | PVANLPBPAGEHJA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|