C12H13BrF3NO3S — CID 142309460
1-[4-bromo-2-(trifluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol (PubChem CID 142309460) has the molecular formula C12H13BrF3NO3S and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 142309460 |
| Molecular Formula | C12H13BrF3NO3S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol |
| SMILES | O=S(c1ccc(Br)cc1C(F)(F)F)N1CCC(O)(CO)C1 |
| InChI | InChI=1S/C12H13BrF3NO3S/c13-8-1-2-10(9(5-8)12(14,15)16)21(20)17-4-3-11(19,6-17)7-18/h1-2,5,18-19H,3-4,6-7H2 |
| InChIKey | WWQHWHSHSWKNAE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |