C12H14F3NOS — CID 86065982
1-[2-(trifluoromethyl)phenyl]sulfinylpiperidine (PubChem CID 86065982) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]sulfinylpiperidine.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]sulfinylpiperidine |
|---|---|
| PubChem CID | 86065982 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]sulfinylpiperidine |
| SMILES | O=S(c1ccccc1C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)10-6-2-3-7-11(10)18(17)16-8-4-1-5-9-16/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | WWLBGCIUEMRKNJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |