C19H20ClFN2O3S2 — CID 142309768
1-[2-chloro-4-(fluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol;4-sulfanylbenzonitrile (PubChem CID 142309768) has the molecular formula C19H20ClFN2O3S2 and a molecular weight of 442.97 g/mol. Its IUPAC name is 1-[2-chloro-4-(fluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol;4-sulfanylbenzonitrile.
| Compound Name | 1-[2-chloro-4-(fluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol;4-sulfanylbenzonitrile |
|---|---|
| PubChem CID | 142309768 |
| Molecular Formula | C19H20ClFN2O3S2 |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[2-chloro-4-(fluoromethyl)phenyl]sulfinyl-3-(hydroxymethyl)pyrrolidin-3-ol;4-sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(S)cc1.O=S(c1ccc(CF)cc1Cl)N1CCC(O)(CO)C1 |
| InChI | InChI=1S/C12H15ClFNO3S.C7H5NS/c13-10-5-9(6-14)1-2-11(10)19(18)15-4-3-12(17,7-15)8-16;8-5-6-1-3-7(9)4-2-6/h1-2,5,16-17H,3-4,6-8H2;1-4,9H |
| InChIKey | UGYXIBQEMSFDGV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|