C12H19N3O2 — CID 142312614
ethynyl 2-[4-(2-methylbutyl)triazol-1-yl]acetate;methane (PubChem CID 142312614) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethynyl 2-[4-(2-methylbutyl)triazol-1-yl]acetate;methane.
| Compound Name | ethynyl 2-[4-(2-methylbutyl)triazol-1-yl]acetate;methane |
|---|---|
| PubChem CID | 142312614 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | ethynyl 2-[4-(2-methylbutyl)triazol-1-yl]acetate;methane |
| SMILES | C.C#COC(=O)Cn1cc(CC(C)CC)nn1 |
| InChI | InChI=1S/C11H15N3O2.CH4/c1-4-9(3)6-10-7-14(13-12-10)8-11(15)16-5-2;/h2,7,9H,4,6,8H2,1,3H3;1H4 |
| InChIKey | DROGBIOCWSEYDE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|