C13H25N5O2 — CID 157381511
methane;3-(methylamino)-4-[1-[2-(methylamino)-3-oxobutyl]triazol-4-yl]butan-2-one (PubChem CID 157381511) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is methane;3-(methylamino)-4-[1-[2-(methylamino)-3-oxobutyl]triazol-4-yl]butan-2-one.
| Compound Name | methane;3-(methylamino)-4-[1-[2-(methylamino)-3-oxobutyl]triazol-4-yl]butan-2-one |
|---|---|
| PubChem CID | 157381511 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | methane;3-(methylamino)-4-[1-[2-(methylamino)-3-oxobutyl]triazol-4-yl]butan-2-one |
| SMILES | C.CNC(Cc1cn(CC(NC)C(C)=O)nn1)C(C)=O |
| InChI | InChI=1S/C12H21N5O2.CH4/c1-8(18)11(13-3)5-10-6-17(16-15-10)7-12(14-4)9(2)19;/h6,11-14H,5,7H2,1-4H3;1H4 |
| InChIKey | BKXZKNJARYGCJJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |