C28H50N5O5+ — CID 170732703
ethane;2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[2-[4-[2-(methylamino)-3-oxobutyl]phenoxy]ethyl]triazol-4-yl]ethyl]azanium (PubChem CID 170732703) has the molecular formula C28H50N5O5+ and a molecular weight of 536.74 g/mol. Its IUPAC name is ethane;2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[2-[4-[2-(methylamino)-3-oxobutyl]phenoxy]ethyl]triazol-4-yl]ethyl]azanium.
| Compound Name | ethane;2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[2-[4-[2-(methylamino)-3-oxobutyl]phenoxy]ethyl]triazol-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 170732703 |
| Molecular Formula | C28H50N5O5+ |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | ethane;2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[2-[4-[2-(methylamino)-3-oxobutyl]phenoxy]ethyl]triazol-4-yl]ethyl]azanium |
| SMILES | CC.CNC(Cc1ccc(OCCn2cc(CC[N+](C)(C)CCOCCOCCOC)nn2)cc1)C(C)=O |
| InChI | InChI=1S/C26H44N5O5.C2H6/c1-22(32)26(27-2)20-23-6-8-25(9-7-23)36-14-11-30-21-24(28-29-30)10-12-31(3,4)13-15-34-18-19-35-17-16-33-5;1-2/h6-9,21,26-27H,10-20H2,1-5H3;1-2H3/q+1; |
| InChIKey | VVLVPWDYKLQINX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|