C18H36N5O4+ — CID 170732713
2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[(2S)-2-(methylamino)-3-oxobutyl]triazol-4-yl]ethyl]azanium (PubChem CID 170732713) has the molecular formula C18H36N5O4+ and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[(2S)-2-(methylamino)-3-oxobutyl]triazol-4-yl]ethyl]azanium.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[(2S)-2-(methylamino)-3-oxobutyl]triazol-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 170732713 |
| Molecular Formula | C18H36N5O4+ |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl-dimethyl-[2-[1-[(2S)-2-(methylamino)-3-oxobutyl]triazol-4-yl]ethyl]azanium |
| SMILES | CN[C@@H](Cn1cc(CC[N+](C)(C)CCOCCOCCOC)nn1)C(C)=O |
| InChI | InChI=1S/C18H36N5O4/c1-16(24)18(19-2)15-22-14-17(20-21-22)6-7-23(3,4)8-9-26-12-13-27-11-10-25-5/h14,18-19H,6-13,15H2,1-5H3/q+1/t18-/m0/s1 |
| InChIKey | UGEIVEUXOMZIFO-SFHVURJKSA-N |
| XLogP | -0.25 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|