C29H41N3O4 — CID 142313768
tert-butyl 3-[2-[4-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanoate (PubChem CID 142313768) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[4-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 142313768 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | tert-butyl 3-[2-[4-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1ccc(CN2CCC3(CC2)CN(c2ccccn2)CCO3)cc1 |
| InChI | InChI=1S/C29H41N3O4/c1-28(2,3)36-27(33)12-20-34-19-11-24-7-9-25(10-8-24)22-31-16-13-29(14-17-31)23-32(18-21-35-29)26-6-4-5-15-30-26/h4-10,15H,11-14,16-23H2,1-3H3 |
| InChIKey | YGSAXONJQDRPIA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|