C18H41N3O2S — CID 142314195
ethane;1-(2-methyl-3-oxobutan-2-yl)-3-[2-(5-methylsulfanylpentylamino)ethyl]urea (PubChem CID 142314195) has the molecular formula C18H41N3O2S and a molecular weight of 363.61 g/mol. Its IUPAC name is ethane;1-(2-methyl-3-oxobutan-2-yl)-3-[2-(5-methylsulfanylpentylamino)ethyl]urea.
| Compound Name | ethane;1-(2-methyl-3-oxobutan-2-yl)-3-[2-(5-methylsulfanylpentylamino)ethyl]urea |
|---|---|
| PubChem CID | 142314195 |
| Molecular Formula | C18H41N3O2S |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | ethane;1-(2-methyl-3-oxobutan-2-yl)-3-[2-(5-methylsulfanylpentylamino)ethyl]urea |
| SMILES | CC.CC.CSCCCCCNCCNC(=O)NC(C)(C)C(C)=O |
| InChI | InChI=1S/C14H29N3O2S.2C2H6/c1-12(18)14(2,3)17-13(19)16-10-9-15-8-6-5-7-11-20-4;2*1-2/h15H,5-11H2,1-4H3,(H2,16,17,19);2*1-2H3 |
| InChIKey | FBERFWFNGMCSJR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|