C26H52N4O4S2 — CID 163902793
5-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]carbamoylamino]ethylamino]-N,N-bis(6-methylsulfanylhexyl)pentanamide (PubChem CID 163902793) has the molecular formula C26H52N4O4S2 and a molecular weight of 548.86 g/mol. Its IUPAC name is 5-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]carbamoylamino]ethylamino]-N,N-bis(6-methylsulfanylhexyl)pentanamide.
| Compound Name | 5-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]carbamoylamino]ethylamino]-N,N-bis(6-methylsulfanylhexyl)pentanamide |
|---|---|
| PubChem CID | 163902793 |
| Molecular Formula | C26H52N4O4S2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 5-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]carbamoylamino]ethylamino]-N,N-bis(6-methylsulfanylhexyl)pentanamide |
| SMILES | CSCCCCCCN(CCCCCCSC)C(=O)CCCCNCCNC(=O)N[C@@H](CO)C(C)=O |
| InChI | InChI=1S/C26H52N4O4S2/c1-23(32)24(22-31)29-26(34)28-17-16-27-15-9-8-14-25(33)30(18-10-4-6-12-20-35-2)19-11-5-7-13-21-36-3/h24,27,31H,4-22H2,1-3H3,(H2,28,29,34)/t24-/m0/s1 |
| InChIKey | QLIAXYNSUZGSJO-DEOSSOPVSA-N |
| XLogP | 3.67 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|