C31H33N3O8 — CID 142317097
N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-2-methyl-4-(3-methylphenyl)-1,3-oxazole-5-carboxamide;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 142317097) has the molecular formula C31H33N3O8 and a molecular weight of 575.62 g/mol. Its IUPAC name is N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-2-methyl-4-(3-methylphenyl)-1,3-oxazole-5-carboxamide;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-2-methyl-4-(3-methylphenyl)-1,3-oxazole-5-carboxamide;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 142317097 |
| Molecular Formula | C31H33N3O8 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-2-methyl-4-(3-methylphenyl)-1,3-oxazole-5-carboxamide;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | C=C1C(=O)OC2(CCCC2)OC1=O.Cc1cccc(-c2nc(C)oc2C(=O)NC(Cc2ccccc2)C(O)C(N)=O)c1 |
| InChI | InChI=1S/C22H23N3O4.C9H10O4/c1-13-7-6-10-16(11-13)18-20(29-14(2)24-18)22(28)25-17(19(26)21(23)27)12-15-8-4-3-5-9-15;1-6-7(10)12-9(13-8(6)11)4-2-3-5-9/h3-11,17,19,26H,12H2,1-2H3,(H2,23,27)(H,25,28);1-5H2 |
| InChIKey | VMLUEXRZHRIONC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|