C15H23F3Si — CID 142317297
dimethyl-(4-phenylbutan-2-yl)-(3,3,3-trifluoropropyl)silane (PubChem CID 142317297) has the molecular formula C15H23F3Si and a molecular weight of 288.43 g/mol. Its IUPAC name is dimethyl-(4-phenylbutan-2-yl)-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl-(4-phenylbutan-2-yl)-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 142317297 |
| Molecular Formula | C15H23F3Si |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | dimethyl-(4-phenylbutan-2-yl)-(3,3,3-trifluoropropyl)silane |
| SMILES | CC(CCc1ccccc1)[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C15H23F3Si/c1-13(9-10-14-7-5-4-6-8-14)19(2,3)12-11-15(16,17)18/h4-8,13H,9-12H2,1-3H3 |
| InChIKey | MXQNYKGWYRYVBO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|