C16H21N3O3 — CID 142319359
2-cyclopropyl-2-formamidobutanoic acid;3-(methylamino)benzonitrile (PubChem CID 142319359) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-cyclopropyl-2-formamidobutanoic acid;3-(methylamino)benzonitrile.
| Compound Name | 2-cyclopropyl-2-formamidobutanoic acid;3-(methylamino)benzonitrile |
|---|---|
| PubChem CID | 142319359 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-cyclopropyl-2-formamidobutanoic acid;3-(methylamino)benzonitrile |
| SMILES | CCC(NC=O)(C(=O)O)C1CC1.CNc1cccc(C#N)c1 |
| InChI | InChI=1S/C8H8N2.C8H13NO3/c1-10-8-4-2-3-7(5-8)6-9;1-2-8(7(11)12,9-5-10)6-3-4-6/h2-5,10H,1H3;5-6H,2-4H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | FXSFVZKCYAOBKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|