C18H17O3S — CID 142319800
CID 142319800 (PubChem CID 142319800) has the molecular formula C18H17O3S and a molecular weight of 313.40 g/mol.
| Compound Name | CID 142319800 |
|---|---|
| PubChem CID | 142319800 |
| Molecular Formula | C18H17O3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | — |
| SMILES | COc1cc2cc(C(=O)C[C@H](C)C(=O)C3=C[CH]3)sc2cc1C |
| InChI | InChI=1S/C18H17O3S/c1-10-7-16-13(8-15(10)21-3)9-17(22-16)14(19)6-11(2)18(20)12-4-5-12/h4-5,7-9,11H,6H2,1-3H3/t11-/m0/s1 |
| InChIKey | MWOZOJLXCWGGHO-NSHDSACASA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |