C14H17N3O3 — CID 142319964
(Z)-2-amino-3-[4-[(2-methylprop-2-enoylamino)methyl]anilino]prop-2-enoic acid (PubChem CID 142319964) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (Z)-2-amino-3-[4-[(2-methylprop-2-enoylamino)methyl]anilino]prop-2-enoic acid.
| Compound Name | (Z)-2-amino-3-[4-[(2-methylprop-2-enoylamino)methyl]anilino]prop-2-enoic acid |
|---|---|
| PubChem CID | 142319964 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (Z)-2-amino-3-[4-[(2-methylprop-2-enoylamino)methyl]anilino]prop-2-enoic acid |
| SMILES | C=C(C)C(=O)NCc1ccc(N/C=C(\N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H17N3O3/c1-9(2)13(18)17-7-10-3-5-11(6-4-10)16-8-12(15)14(19)20/h3-6,8,16H,1,7,15H2,2H3,(H,17,18)(H,19,20)/b12-8- |
| InChIKey | RGAOUDYBAHFRDW-WQLSENKSSA-N |
| XLogP | 1.18 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|