C23H20FN3O3 — CID 142322161
2-[1-(2-cyclopropyl-2-hydroxyethyl)-3-(4-fluorophenyl)-4-methylpyrazol-5-yl]isoindole-1,3-dione (PubChem CID 142322161) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-[1-(2-cyclopropyl-2-hydroxyethyl)-3-(4-fluorophenyl)-4-methylpyrazol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(2-cyclopropyl-2-hydroxyethyl)-3-(4-fluorophenyl)-4-methylpyrazol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142322161 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[1-(2-cyclopropyl-2-hydroxyethyl)-3-(4-fluorophenyl)-4-methylpyrazol-5-yl]isoindole-1,3-dione |
| SMILES | Cc1c(-c2ccc(F)cc2)nn(CC(O)C2CC2)c1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H20FN3O3/c1-13-20(15-8-10-16(24)11-9-15)25-26(12-19(28)14-6-7-14)21(13)27-22(29)17-4-2-3-5-18(17)23(27)30/h2-5,8-11,14,19,28H,6-7,12H2,1H3 |
| InChIKey | ZTDPNEZQXANZKV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|