C14H19N5O2 — CID 142323170
3-cyclobutyloxybenzene-1,2-diamine;N-(1H-imidazol-2-yl)formamide (PubChem CID 142323170) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-cyclobutyloxybenzene-1,2-diamine;N-(1H-imidazol-2-yl)formamide.
| Compound Name | 3-cyclobutyloxybenzene-1,2-diamine;N-(1H-imidazol-2-yl)formamide |
|---|---|
| PubChem CID | 142323170 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-cyclobutyloxybenzene-1,2-diamine;N-(1H-imidazol-2-yl)formamide |
| SMILES | Nc1cccc(OC2CCC2)c1N.O=CNc1ncc[nH]1 |
| InChI | InChI=1S/C10H14N2O.C4H5N3O/c11-8-5-2-6-9(10(8)12)13-7-3-1-4-7;8-3-7-4-5-1-2-6-4/h2,5-7H,1,3-4,11-12H2;1-3H,(H2,5,6,7,8) |
| InChIKey | UUFKCNIKRYPSDZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|