C12H19N3 — CID 14942290
3-N-cyclohexylbenzene-1,2,3-triamine (PubChem CID 14942290) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-N-cyclohexylbenzene-1,2,3-triamine.
| Compound Name | 3-N-cyclohexylbenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 14942290 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-N-cyclohexylbenzene-1,2,3-triamine |
| SMILES | Nc1cccc(NC2CCCCC2)c1N |
| InChI | InChI=1S/C12H19N3/c13-10-7-4-8-11(12(10)14)15-9-5-2-1-3-6-9/h4,7-9,15H,1-3,5-6,13-14H2 |
| InChIKey | HLTWODISVVPVTL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|