About N-cyclopentyl-2-iodoaniline;2-iodoaniline
N-cyclopentyl-2-iodoaniline;2-iodoaniline (PubChem CID 159046198) has the molecular formula C17H20I2N2
and a molecular weight of 506.17 g/mol. Its IUPAC name is N-cyclopentyl-2-iodoaniline;2-iodoaniline.
Molecular Properties
| Compound Name | N-cyclopentyl-2-iodoaniline;2-iodoaniline |
| PubChem CID | 159046198 |
| Molecular Formula | C17H20I2N2 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | N-cyclopentyl-2-iodoaniline;2-iodoaniline |
| SMILES | Ic1ccccc1NC1CCCC1.Nc1ccccc1I |
| InChI | InChI=1S/C11H14IN.C6H6IN/c12-10-7-3-4-8-11(10)13-9-5-1-2-6-9;7-5-3-1-2-4-6(5)8/h3-4,7-9,13H,1-2,5-6H2;1-4H,8H2 |
| InChIKey | JWRMFWNACBYOQJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-2-iodoaniline;2-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-iodoaniline;2-iodoaniline?
The IUPAC name of N-cyclopentyl-2-iodoaniline;2-iodoaniline (CID 159046198) is N-cyclopentyl-2-iodoaniline;2-iodoaniline.
What is the SMILES notation for N-cyclopentyl-2-iodoaniline;2-iodoaniline?
The canonical SMILES for N-cyclopentyl-2-iodoaniline;2-iodoaniline is Ic1ccccc1NC1CCCC1.Nc1ccccc1I.
What is the InChIKey of N-cyclopentyl-2-iodoaniline;2-iodoaniline?
The InChIKey is JWRMFWNACBYOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14IN.C6H6IN/c12-10-7-3-4-8-11(10)13-9-5-1-2-6-9;7-5-3-1-2-4-6(5)8/h3-4,7-9,13H,1-2,5-6H2;1-4H,8H2.
What are the key properties of N-cyclopentyl-2-iodoaniline;2-iodoaniline?
N-cyclopentyl-2-iodoaniline;2-iodoaniline has a molecular weight of 506.17 g/mol, XLogP of 5.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-iodoaniline;2-iodoaniline is sourced from PubChem (CID 159046198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).