C11H12BrClN2O2 — CID 142325901
(3-bromo-5-chlorophenyl) (3R)-3-aminopyrrolidine-1-carboxylate (PubChem CID 142325901) has the molecular formula C11H12BrClN2O2 and a molecular weight of 319.59 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl) (3R)-3-aminopyrrolidine-1-carboxylate.
| Compound Name | (3-bromo-5-chlorophenyl) (3R)-3-aminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142325901 |
| Molecular Formula | C11H12BrClN2O2 |
| Molecular Weight | 319.59 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | (3-bromo-5-chlorophenyl) (3R)-3-aminopyrrolidine-1-carboxylate |
| SMILES | N[C@@H]1CCN(C(=O)Oc2cc(Cl)cc(Br)c2)C1 |
| InChI | InChI=1S/C11H12BrClN2O2/c12-7-3-8(13)5-10(4-7)17-11(16)15-2-1-9(14)6-15/h3-5,9H,1-2,6,14H2/t9-/m1/s1 |
| InChIKey | WIWVNUSRTIEKSC-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |