C13H29N3O — CID 142327055
N-(3-amino-1-methylpiperidin-4-yl)-3-methylbutanamide;ethane (PubChem CID 142327055) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(3-amino-1-methylpiperidin-4-yl)-3-methylbutanamide;ethane.
| Compound Name | N-(3-amino-1-methylpiperidin-4-yl)-3-methylbutanamide;ethane |
|---|---|
| PubChem CID | 142327055 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | N-(3-amino-1-methylpiperidin-4-yl)-3-methylbutanamide;ethane |
| SMILES | CC.CC(C)CC(=O)NC1CCN(C)CC1N |
| InChI | InChI=1S/C11H23N3O.C2H6/c1-8(2)6-11(15)13-10-4-5-14(3)7-9(10)12;1-2/h8-10H,4-7,12H2,1-3H3,(H,13,15);1-2H3 |
| InChIKey | FCRQGWLMKGIAPW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |