C13H24N2O4 — CID 77259572
3-methyl-N-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)butanamide (PubChem CID 77259572) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-methyl-N-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)butanamide.
| Compound Name | 3-methyl-N-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)butanamide |
|---|---|
| PubChem CID | 77259572 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-methyl-N-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)butanamide |
| SMILES | CC(C)CC(=O)NC1CN2CCC(O)C2C(O)C1O |
| InChI | InChI=1S/C13H24N2O4/c1-7(2)5-10(17)14-8-6-15-4-3-9(16)11(15)13(19)12(8)18/h7-9,11-13,16,18-19H,3-6H2,1-2H3,(H,14,17) |
| InChIKey | CIZOTVLCKOIKQA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |