C11H21N3O4 — CID 77386335
1,1-dimethyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea (PubChem CID 77386335) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1,1-dimethyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea.
| Compound Name | 1,1-dimethyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
|---|---|
| PubChem CID | 77386335 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1,1-dimethyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
| SMILES | CN(C)C(=O)NC1CN2CCC(O)C2C(O)C1O |
| InChI | InChI=1S/C11H21N3O4/c1-13(2)11(18)12-6-5-14-4-3-7(15)8(14)10(17)9(6)16/h6-10,15-17H,3-5H2,1-2H3,(H,12,18) |
| InChIKey | KQAZZMRPPNJETP-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |