C12H23N3O4 — CID 77389932
1-propyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea (PubChem CID 77389932) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-propyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea.
| Compound Name | 1-propyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
|---|---|
| PubChem CID | 77389932 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-propyl-3-(1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
| SMILES | CCCNC(=O)NC1CN2CCC(O)C2C(O)C1O |
| InChI | InChI=1S/C12H23N3O4/c1-2-4-13-12(19)14-7-6-15-5-3-8(16)9(15)11(18)10(7)17/h7-11,16-18H,2-6H2,1H3,(H2,13,14,19) |
| InChIKey | ZZRLXSUTCDRMFR-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |