C13H23NO5 — CID 10683657
[(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 2,2-dimethylpropanoate (PubChem CID 10683657) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10683657 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1[C@H](O)[C@H]2[C@@H](O)CCN2C[C@@H]1O |
| InChI | InChI=1S/C13H23NO5/c1-13(2,3)12(18)19-11-8(16)6-14-5-4-7(15)9(14)10(11)17/h7-11,15-17H,4-6H2,1-3H3/t7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | QYHKFZSWQZVJSM-FBDQPXRJSA-N |
| XLogP | -0.89 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |