C14H25NO5 — CID 11709029
[(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3,3-dimethylbutanoate (PubChem CID 11709029) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3,3-dimethylbutanoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 11709029 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)O[C@@H]1C(O)CN2CC[C@H](O)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C14H25NO5/c1-14(2,3)6-10(18)20-13-9(17)7-15-5-4-8(16)11(15)12(13)19/h8-9,11-13,16-17,19H,4-7H2,1-3H3/t8-,9?,11+,12+,13+/m0/s1 |
| InChIKey | DOLISIKMCKKRBI-OUVGTOJASA-N |
| XLogP | -0.50 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |