C38H21N3OPtS2 — CID 142328029
platinum(2+);2-[9-(3-pyridin-2-yl-5-thiophen-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-6-thiophen-2-yl-1,3-benzoxazole (PubChem CID 142328029) has the molecular formula C38H21N3OPtS2 and a molecular weight of 794.82 g/mol. Its IUPAC name is platinum(2+);2-[9-(3-pyridin-2-yl-5-thiophen-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-6-thiophen-2-yl-1,3-benzoxazole.
| Compound Name | platinum(2+);2-[9-(3-pyridin-2-yl-5-thiophen-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-6-thiophen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 142328029 |
| Molecular Formula | C38H21N3OPtS2 |
| Molecular Weight | 794.82 g/mol |
| Exact Mass | 794.08 |
| IUPAC Name | platinum(2+);2-[9-(3-pyridin-2-yl-5-thiophen-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-6-thiophen-2-yl-1,3-benzoxazole |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)cc(-c2cccs2)cc1-n1c2[c-]c(-c3nc4ccc(-c5cccs5)cc4o3)ccc2c2ccccc21 |
| InChI | InChI=1S/C38H21N3OS2.Pt/c1-2-9-33-29(7-1)30-14-12-25(38-40-32-15-13-24(23-35(32)42-38)36-10-5-17-43-36)22-34(30)41(33)28-20-26(31-8-3-4-16-39-31)19-27(21-28)37-11-6-18-44-37;/h1-19,21,23H;/q-2;+2 |
| InChIKey | PMFJAHDJUHPHLA-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.82 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|