C34H22N4O — CID 142328957
2-[9-(5-pyridin-2-yl-2-pyrrol-1-ylphenyl)carbazol-2-yl]-1,3-benzoxazole (PubChem CID 142328957) has the molecular formula C34H22N4O and a molecular weight of 502.58 g/mol. Its IUPAC name is 2-[9-(5-pyridin-2-yl-2-pyrrol-1-ylphenyl)carbazol-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-(5-pyridin-2-yl-2-pyrrol-1-ylphenyl)carbazol-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142328957 |
| Molecular Formula | C34H22N4O |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[9-(5-pyridin-2-yl-2-pyrrol-1-ylphenyl)carbazol-2-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2ccc(-n3cccc3)c(-n3c4ccccc4c4ccc(-c5nc6ccccc6o5)cc43)c2)nc1 |
| InChI | InChI=1S/C34H22N4O/c1-3-12-29-25(9-1)26-16-14-24(34-36-28-11-2-4-13-33(28)39-34)22-31(26)38(29)32-21-23(27-10-5-6-18-35-27)15-17-30(32)37-19-7-8-20-37/h1-22H |
| InChIKey | WGZWBLJLAQITOZ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|