C38H25N5O — CID 142328301
2-[9-[2-pyrrol-1-yl-5-(5-pyrrol-1-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzoxazole (PubChem CID 142328301) has the molecular formula C38H25N5O and a molecular weight of 567.65 g/mol. Its IUPAC name is 2-[9-[2-pyrrol-1-yl-5-(5-pyrrol-1-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-[2-pyrrol-1-yl-5-(5-pyrrol-1-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142328301 |
| Molecular Formula | C38H25N5O |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 2-[9-[2-pyrrol-1-yl-5-(5-pyrrol-1-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc4c5ccccc5n(-c5cc(-c6ccc(-n7cccc7)cn6)ccc5-n5cccc5)c4c3)nc2c1 |
| InChI | InChI=1S/C38H25N5O/c1-3-11-33-29(9-1)30-16-13-27(38-40-32-10-2-4-12-37(32)44-38)24-35(30)43(33)36-23-26(14-18-34(36)42-21-7-8-22-42)31-17-15-28(25-39-31)41-19-5-6-20-41/h1-25H |
| InChIKey | DCIFSNIULPJLTQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|