C23H28N10O3 — CID 142329854
(2-hydroxyethanimidoyl) 6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carboximidate (PubChem CID 142329854) has the molecular formula C23H28N10O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is (2-hydroxyethanimidoyl) 6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carboximidate.
| Compound Name | (2-hydroxyethanimidoyl) 6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 142329854 |
| Molecular Formula | C23H28N10O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (2-hydroxyethanimidoyl) 6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(CO)=N/[H])c1cnc(N/C(N)=C/C=C(/C)N)cc1Nc1cccc(-c2ncn(C)n2)c1OC |
| InChI | InChI=1S/C23H28N10O3/c1-13(24)7-8-18(25)31-20-9-17(15(10-28-20)22(27)36-19(26)11-34)30-16-6-4-5-14(21(16)35-3)23-29-12-33(2)32-23/h4-10,12,26-27,34H,11,24-25H2,1-3H3,(H2,28,30,31)/b13-7-,18-8+,26-19+,27-22- |
| InChIKey | KOVRMOIHDDCYFC-XEUWCFNTSA-N |
| XLogP | 2.02 |
| TPSA | 206.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|