About 4-bromobenzene-1,2-diamine;methoxycyclohexane
4-bromobenzene-1,2-diamine;methoxycyclohexane (PubChem CID 142331232) has the molecular formula C13H21BrN2O
and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-bromobenzene-1,2-diamine;methoxycyclohexane.
Molecular Properties
| Compound Name | 4-bromobenzene-1,2-diamine;methoxycyclohexane |
| PubChem CID | 142331232 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-bromobenzene-1,2-diamine;methoxycyclohexane |
| SMILES | COC1CCCCC1.Nc1ccc(Br)cc1N |
| InChI | InChI=1S/C7H14O.C6H7BrN2/c1-8-7-5-3-2-4-6-7;7-4-1-2-5(8)6(9)3-4/h7H,2-6H2,1H3;1-3H,8-9H2 |
| InChIKey | ANUNGBLILCOQBC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzene-1,2-diamine;methoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzene-1,2-diamine;methoxycyclohexane?
The IUPAC name of 4-bromobenzene-1,2-diamine;methoxycyclohexane (CID 142331232) is 4-bromobenzene-1,2-diamine;methoxycyclohexane.
What is the SMILES notation for 4-bromobenzene-1,2-diamine;methoxycyclohexane?
The canonical SMILES for 4-bromobenzene-1,2-diamine;methoxycyclohexane is COC1CCCCC1.Nc1ccc(Br)cc1N.
What is the InChIKey of 4-bromobenzene-1,2-diamine;methoxycyclohexane?
The InChIKey is ANUNGBLILCOQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C6H7BrN2/c1-8-7-5-3-2-4-6-7;7-4-1-2-5(8)6(9)3-4/h7H,2-6H2,1H3;1-3H,8-9H2.
What are the key properties of 4-bromobenzene-1,2-diamine;methoxycyclohexane?
4-bromobenzene-1,2-diamine;methoxycyclohexane has a molecular weight of 301.23 g/mol, XLogP of 3.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzene-1,2-diamine;methoxycyclohexane is sourced from PubChem (CID 142331232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).