C13H21BrN2O — CID 142331232
4-bromobenzene-1,2-diamine;methoxycyclohexane (PubChem CID 142331232) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-bromobenzene-1,2-diamine;methoxycyclohexane.
| Compound Name | 4-bromobenzene-1,2-diamine;methoxycyclohexane |
|---|---|
| PubChem CID | 142331232 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-bromobenzene-1,2-diamine;methoxycyclohexane |
| SMILES | COC1CCCCC1.Nc1ccc(Br)cc1N |
| InChI | InChI=1S/C7H14O.C6H7BrN2/c1-8-7-5-3-2-4-6-7;7-4-1-2-5(8)6(9)3-4/h7H,2-6H2,1H3;1-3H,8-9H2 |
| InChIKey | ANUNGBLILCOQBC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|