C17H19N3 — CID 142333928
5-[4-(methylamino)-3-(3-methylbuta-1,3-dien-2-yl)phenyl]pyridin-3-amine (PubChem CID 142333928) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-[4-(methylamino)-3-(3-methylbuta-1,3-dien-2-yl)phenyl]pyridin-3-amine.
| Compound Name | 5-[4-(methylamino)-3-(3-methylbuta-1,3-dien-2-yl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 142333928 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 5-[4-(methylamino)-3-(3-methylbuta-1,3-dien-2-yl)phenyl]pyridin-3-amine |
| SMILES | C=C(C)C(=C)c1cc(-c2cncc(N)c2)ccc1NC |
| InChI | InChI=1S/C17H19N3/c1-11(2)12(3)16-8-13(5-6-17(16)19-4)14-7-15(18)10-20-9-14/h5-10,19H,1,3,18H2,2,4H3 |
| InChIKey | CKQNQSOVGWOZJF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|