C28H28FNO2 — CID 142337616
ethyl 3-[3-(benzhydrylideneamino)phenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate (PubChem CID 142337616) has the molecular formula C28H28FNO2 and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl 3-[3-(benzhydrylideneamino)phenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate.
| Compound Name | ethyl 3-[3-(benzhydrylideneamino)phenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 142337616 |
| Molecular Formula | C28H28FNO2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | ethyl 3-[3-(benzhydrylideneamino)phenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(F)C(c1cccc(N=C(c2ccccc2)c2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C28H28FNO2/c1-3-32-27(31)28(2,29)25(20-17-18-20)23-15-10-16-24(19-23)30-26(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-16,19-20,25H,3,17-18H2,1-2H3 |
| InChIKey | KKLOUVHIOKLBHO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|