C25H48 — CID 142338011
4-(3-cyclohexylpentyl)-1,2-di(propan-2-yl)cyclohexane;ethene (PubChem CID 142338011) has the molecular formula C25H48 and a molecular weight of 348.66 g/mol. Its IUPAC name is 4-(3-cyclohexylpentyl)-1,2-di(propan-2-yl)cyclohexane;ethene.
| Compound Name | 4-(3-cyclohexylpentyl)-1,2-di(propan-2-yl)cyclohexane;ethene |
|---|---|
| PubChem CID | 142338011 |
| Molecular Formula | C25H48 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 348.38 |
| IUPAC Name | 4-(3-cyclohexylpentyl)-1,2-di(propan-2-yl)cyclohexane;ethene |
| SMILES | C=C.CCC(CCC1CCC(C(C)C)C(C(C)C)C1)C1CCCCC1 |
| InChI | InChI=1S/C23H44.C2H4/c1-6-20(21-10-8-7-9-11-21)14-12-19-13-15-22(17(2)3)23(16-19)18(4)5;1-2/h17-23H,6-16H2,1-5H3;1-2H2 |
| InChIKey | GATCUYGVWDJUNE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|