C8H4Br2FNS — CID 142338304
2-bromo-6-(bromomethyl)-5-fluoro-1,3-benzothiazole (PubChem CID 142338304) has the molecular formula C8H4Br2FNS and a molecular weight of 325.00 g/mol. Its IUPAC name is 2-bromo-6-(bromomethyl)-5-fluoro-1,3-benzothiazole.
| Compound Name | 2-bromo-6-(bromomethyl)-5-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142338304 |
| Molecular Formula | C8H4Br2FNS |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.84 |
| IUPAC Name | 2-bromo-6-(bromomethyl)-5-fluoro-1,3-benzothiazole |
| SMILES | Fc1cc2nc(Br)sc2cc1CBr |
| InChI | InChI=1S/C8H4Br2FNS/c9-3-4-1-7-6(2-5(4)11)12-8(10)13-7/h1-2H,3H2 |
| InChIKey | ZBGSUMCCCBXJPG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|