About but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide
but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide (PubChem CID 142338610) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide.
Molecular Properties
| Compound Name | but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide |
| PubChem CID | 142338610 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide |
| SMILES | CC=CC.Cc1ccc(C(=O)NCCS)cc1 |
| InChI | InChI=1S/C10H13NOS.C4H8/c1-8-2-4-9(5-3-8)10(12)11-6-7-13;1-3-4-2/h2-5,13H,6-7H2,1H3,(H,11,12);3-4H,1-2H3 |
| InChIKey | RMEKCIQDNYDNMY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide?
The IUPAC name of but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide (CID 142338610) is but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide.
What is the SMILES notation for but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide?
The canonical SMILES for but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide is CC=CC.Cc1ccc(C(=O)NCCS)cc1.
What is the InChIKey of but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide?
The InChIKey is RMEKCIQDNYDNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NOS.C4H8/c1-8-2-4-9(5-3-8)10(12)11-6-7-13;1-3-4-2/h2-5,13H,6-7H2,1H3,(H,11,12);3-4H,1-2H3.
What are the key properties of but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide?
but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide has a molecular weight of 251.39 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;4-methyl-N-(2-sulfanylethyl)benzamide is sourced from PubChem (CID 142338610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).