C11H17NO — CID 142339029
4-[(3E)-4-methylhexa-1,3,5-trien-2-yl]morpholine (PubChem CID 142339029) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-[(3E)-4-methylhexa-1,3,5-trien-2-yl]morpholine.
| Compound Name | 4-[(3E)-4-methylhexa-1,3,5-trien-2-yl]morpholine |
|---|---|
| PubChem CID | 142339029 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-[(3E)-4-methylhexa-1,3,5-trien-2-yl]morpholine |
| SMILES | C=C/C(C)=C/C(=C)N1CCOCC1 |
| InChI | InChI=1S/C11H17NO/c1-4-10(2)9-11(3)12-5-7-13-8-6-12/h4,9H,1,3,5-8H2,2H3/b10-9+ |
| InChIKey | KTGRGUHMXJORCE-MDZDMXLPSA-N |
| XLogP | 1.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|