C11H19NO2 — CID 10932405
4-[(3E)-5-methoxy-3-methylpenta-1,3-dien-2-yl]morpholine (PubChem CID 10932405) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-[(3E)-5-methoxy-3-methylpenta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(3E)-5-methoxy-3-methylpenta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 10932405 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-[(3E)-5-methoxy-3-methylpenta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C(C)=C/COC)N1CCOCC1 |
| InChI | InChI=1S/C11H19NO2/c1-10(4-7-13-3)11(2)12-5-8-14-9-6-12/h4H,2,5-9H2,1,3H3/b10-4+ |
| InChIKey | JEAGRAPEQZZXOP-ONNFQVAWSA-N |
| XLogP | 1.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|