C12H21NO2 — CID 123820756
4-(3-methoxypenta-1,3-dien-2-yl)-2,2-dimethylmorpholine (PubChem CID 123820756) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-(3-methoxypenta-1,3-dien-2-yl)-2,2-dimethylmorpholine.
| Compound Name | 4-(3-methoxypenta-1,3-dien-2-yl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 123820756 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-(3-methoxypenta-1,3-dien-2-yl)-2,2-dimethylmorpholine |
| SMILES | C=C(C(=CC)OC)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO2/c1-6-11(14-5)10(2)13-7-8-15-12(3,4)9-13/h6H,2,7-9H2,1,3-5H3 |
| InChIKey | RHDMDFKVQCLAHI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|