C14H25NO2 — CID 142097271
4-[3-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]propyl]morpholine (PubChem CID 142097271) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-[3-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]propyl]morpholine.
| Compound Name | 4-[3-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]propyl]morpholine |
|---|---|
| PubChem CID | 142097271 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-[3-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]propyl]morpholine |
| SMILES | C/C=C(C)\C=C/COCCCN1CCOCC1 |
| InChI | InChI=1S/C14H25NO2/c1-3-14(2)6-4-10-16-11-5-7-15-8-12-17-13-9-15/h3-4,6H,5,7-13H2,1-2H3/b6-4-,14-3- |
| InChIKey | CODBEFOBHAMDRR-NZJCYXFESA-N |
| XLogP | 2.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|