C34H43N3O9 — CID 142339591
2-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate (PubChem CID 142339591) has the molecular formula C34H43N3O9 and a molecular weight of 637.73 g/mol. Its IUPAC name is 2-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate.
| Compound Name | 2-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142339591 |
| Molecular Formula | C34H43N3O9 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | 2-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C=O)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCOC(=O)C(NC(=O)OC(C)(C)C)C(C)CC)cc1OC |
| InChI | InChI=1S/C34H43N3O9/c1-8-20(3)28(37-33(42)46-34(4,5)6)31(40)44-14-15-45-32(41)29-24(12-13-26(36-29)30(39)35-18-21-10-11-21)25-17-27(43-7)22(9-2)16-23(25)19-38/h9,12-13,16-17,19-21,28H,2,8,10-11,14-15,18H2,1,3-7H3,(H,35,39)(H,37,42) |
| InChIKey | QRSPOEBVPBKNLO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|