C29H34N2O7 — CID 159195658
[(2S,3S)-2,3-dimethylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-formyl-5-(hydroxymethyl)phenyl]pyridine-2-carboxylate (PubChem CID 159195658) has the molecular formula C29H34N2O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is [(2S,3S)-2,3-dimethylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-formyl-5-(hydroxymethyl)phenyl]pyridine-2-carboxylate.
| Compound Name | [(2S,3S)-2,3-dimethylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-formyl-5-(hydroxymethyl)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 159195658 |
| Molecular Formula | C29H34N2O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(2S,3S)-2,3-dimethylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-formyl-5-(hydroxymethyl)phenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C=O)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCOC(=O)[C@@H](C)[C@@H](C)CC)cc1CO |
| InChI | InChI=1S/C29H34N2O7/c1-5-17(3)18(4)28(35)37-16-38-29(36)26-23(9-10-25(31-26)27(34)30-13-19-7-8-19)24-12-21(14-32)20(6-2)11-22(24)15-33/h6,9-12,15,17-19,32H,2,5,7-8,13-14,16H2,1,3-4H3,(H,30,34)/t17-,18-/m0/s1 |
| InChIKey | YWGLPAQDNWXETK-ROUUACIJSA-N |
| XLogP | 4.18 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|