C25H34N2O2 — CID 142339257
N-(cyclopropylmethyl)-5-(4-ethenyl-2-formyl-5-methylphenyl)-6-methylpyridine-2-carboxamide;ethane (PubChem CID 142339257) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-(4-ethenyl-2-formyl-5-methylphenyl)-6-methylpyridine-2-carboxamide;ethane.
| Compound Name | N-(cyclopropylmethyl)-5-(4-ethenyl-2-formyl-5-methylphenyl)-6-methylpyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142339257 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-(cyclopropylmethyl)-5-(4-ethenyl-2-formyl-5-methylphenyl)-6-methylpyridine-2-carboxamide;ethane |
| SMILES | C=Cc1cc(C=O)c(-c2ccc(C(=O)NCC3CC3)nc2C)cc1C.CC.CC |
| InChI | InChI=1S/C21H22N2O2.2C2H6/c1-4-16-10-17(12-24)19(9-13(16)2)18-7-8-20(23-14(18)3)21(25)22-11-15-5-6-15;2*1-2/h4,7-10,12,15H,1,5-6,11H2,2-3H3,(H,22,25);2*1-2H3 |
| InChIKey | VWNUOYWVEAYQMY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|