C28H32N2O7 — CID 142339386
[(3S)-3-methylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate (PubChem CID 142339386) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is [(3S)-3-methylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate.
| Compound Name | [(3S)-3-methylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142339386 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [(3S)-3-methylpentanoyl]oxymethyl 6-(cyclopropylmethylcarbamoyl)-3-(4-ethenyl-2-formyl-5-methoxyphenyl)pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C=O)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCOC(=O)C[C@@H](C)CC)cc1OC |
| InChI | InChI=1S/C28H32N2O7/c1-5-17(3)11-25(32)36-16-37-28(34)26-21(9-10-23(30-26)27(33)29-14-18-7-8-18)22-13-24(35-4)19(6-2)12-20(22)15-31/h6,9-10,12-13,15,17-18H,2,5,7-8,11,14,16H2,1,3-4H3,(H,29,33)/t17-/m0/s1 |
| InChIKey | GYJUCRLGCRCFER-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|