C47H90N2O — CID 142339862
N-[3-(dimethylamino)propyl]-N-[(3Z,22Z)-hexacosa-3,22,25-trien-13-yl]-2-hexyldecanamide (PubChem CID 142339862) has the molecular formula C47H90N2O and a molecular weight of 699.25 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-[(3Z,22Z)-hexacosa-3,22,25-trien-13-yl]-2-hexyldecanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-[(3Z,22Z)-hexacosa-3,22,25-trien-13-yl]-2-hexyldecanamide |
|---|---|
| PubChem CID | 142339862 |
| Molecular Formula | C47H90N2O |
| Molecular Weight | 699.25 g/mol |
| Exact Mass | 698.71 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-[(3Z,22Z)-hexacosa-3,22,25-trien-13-yl]-2-hexyldecanamide |
| SMILES | C=CC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CC)N(CCCN(C)C)C(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H90N2O/c1-7-11-15-19-22-24-26-28-30-33-37-42-46(41-36-32-29-27-25-23-20-16-12-8-2)49(44-38-43-48(5)6)47(50)45(39-34-18-14-10-4)40-35-31-21-17-13-9-3/h7,12,15-16,19,45-46H,1,8-11,13-14,17-18,20-44H2,2-6H3/b16-12-,19-15- |
| InChIKey | VXZPZBZRQMJPLT-MENHKMRYSA-N |
| XLogP | 14.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.25 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|